4,4'-Azodicarbonylbis(morpholine)
Catalog No: FT-0696666
CAS No: 10465-82-4
- Chemical Name: 4,4'-Azodicarbonylbis(morpholine)
- Molecular Formula: C10H16N4O4
- Molecular Weight: 256.26
- InChI Key: CHAMTJKQPOMXTI-VAWYXSNFSA-N
- InChI: InChI=1S/C10H16N4O4/c15-9(13-1-5-17-6-2-13)11-12-10(16)14-3-7-18-8-4-14/h1-8H2/b12-11+
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | Diazene-1,2-diylbis(morpholinomethanone) |
|---|---|
| Flash_Point: | 194.3ºC |
| Melting_Point: | 141-143ºC |
| FW: | 256.25800 |
| Density: | 1.46g/cm3 |
| CAS: | 10465-82-4 |
| Bolling_Point: | 397.6ºC at 760mmHg |
| MF: | C10H16N4O4 |
| Density: | 1.46g/cm3 |
|---|---|
| LogP: | 0.21880 |
| Flash_Point: | 194.3ºC |
| Melting_Point: | 141-143ºC |
| FW: | 256.25800 |
| PSA: | 83.80000 |
| Exact_Mass: | 256.11700 |
| MF: | C10H16N4O4 |
| Bolling_Point: | 397.6ºC at 760mmHg |
| Vapor_Pressure: | 1.56E-06mmHg at 25°C |
| Refractive_Index: | 1.626 |
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2934999090 |
| WGK_Germany: | 3 |
| Safety_Statements: | 22-24/25 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)